Back
| Product Name | L-Glutathione reduced BioChemica |
| SKU Number | BCPC4130 |
| CAS Number | 70-18-8 |
| Molecular Formula | C10H17N3O6S |
| Molecular Weight | 307.32 g/mol |
| Purity | ≥98% |
| Appearance | White to off-white crystalline powder |
| Solubility | Soluble in water |
| Storage Conditions | Store in a cool, dry place away from light |
| Shelf Life | 2 years |
| Applications | Antioxidant, skin whitening, immune support |
| Synonyms | GSH, glutathione, L-gamma-glutamyl-L-cysteinylglycine |
| Melting Point | 192-195°C |
| Boiling Point | 374.5°C at 760 mmHg |
| Density | 1.404 g/cm3 |
| Flash Point | 179.9°C |
| Refractive Index | 1.643 |
| Canonical SMILES | C(C(=O)C(C(C(=O)NCC(=O)N)N)O)C(C(=O)NCC(=O)N)S |
| InChI Key | MXXWOMGUGJBKIW-FUZZCJBVBK |
| PubChem CID | 124886 |
FAQ
What is L-Glutathione reduced BioChemica?
L-Glutathione reduced BioChemica is a natural antioxidant that plays a crucial role in protecting cells from damage caused by free radicals and toxins. It is the reduced form of glutathione, which means it is in its active state and readily available for use by the body.
How does L-Glutathione reduced BioChemica benefit the body?
L-Glutathione reduced BioChemica offers a wide range of health benefits, including:
1. Detoxification: L-Glutathione reduced BioChemica helps the body to eliminate toxins and harmful substances, promoting overall well-being.
2. Immune system support: L-Glutathione reduced BioChemica boosts the immune system by enhancing the function of white blood cells and protecting against infections.
3. Skin health: L-Glutathione reduced BioChemica is known for its skin-lightening properties and ability to reduce the appearance of age spots, acne, and other blemishes.
4. Anti-aging effects: L-Glutathione reduced BioChemica helps to neutralize free radicals that contribute to aging, promoting youthful and healthy skin.
5. Liver support: L-Glutathione reduced BioChemica plays a vital role in liver function by aiding in detoxification and protecting against damage.
Who can benefit from taking L-Glutathione reduced BioChemica?
L-Glutathione reduced BioChemica is beneficial for a wide range of individuals, including:
1. Those looking to improve their overall health and well-being.
2. Individuals seeking to boost their immune system and protect against illnesses.
3. People wanting to achieve brighter, clearer skin and reduce signs of aging.
4. Those looking to support their liver function and detoxify their body.
5. Anyone interested in incorporating a powerful antioxidant into their daily routine for optimal health.
Are there any side effects associated with taking L-Glutathione reduced BioChemica?
L-Glutathione reduced BioChemica is generally safe for most people when taken at recommended doses. However, some individuals may experience mild side effects such as nausea, stomach upset, or allergic reactions. It is essential to consult with a healthcare professional before starting any new supplement regimen, especially if you have underlying health conditions or are pregnant or nursing.
How should L-Glutathione reduced BioChemica be taken for maximum effectiveness?
To optimize the benefits of L-Glutathione reduced BioChemica, it is essential to follow the recommended dosage instructions provided on the product packaging or by a healthcare provider. It is typically taken in capsule or powder form, with or without food, depending on the individual's preferences. Consistency is key when taking L-Glutathione reduced BioChemica, so it is essential to establish a daily routine to ensure optimal results.
L-Glutathione reduced BioChemica is a natural antioxidant that plays a crucial role in protecting cells from damage caused by free radicals and toxins. It is the reduced form of glutathione, which means it is in its active state and readily available for use by the body.
How does L-Glutathione reduced BioChemica benefit the body?
L-Glutathione reduced BioChemica offers a wide range of health benefits, including:
1. Detoxification: L-Glutathione reduced BioChemica helps the body to eliminate toxins and harmful substances, promoting overall well-being.
2. Immune system support: L-Glutathione reduced BioChemica boosts the immune system by enhancing the function of white blood cells and protecting against infections.
3. Skin health: L-Glutathione reduced BioChemica is known for its skin-lightening properties and ability to reduce the appearance of age spots, acne, and other blemishes.
4. Anti-aging effects: L-Glutathione reduced BioChemica helps to neutralize free radicals that contribute to aging, promoting youthful and healthy skin.
5. Liver support: L-Glutathione reduced BioChemica plays a vital role in liver function by aiding in detoxification and protecting against damage.
Who can benefit from taking L-Glutathione reduced BioChemica?
L-Glutathione reduced BioChemica is beneficial for a wide range of individuals, including:
1. Those looking to improve their overall health and well-being.
2. Individuals seeking to boost their immune system and protect against illnesses.
3. People wanting to achieve brighter, clearer skin and reduce signs of aging.
4. Those looking to support their liver function and detoxify their body.
5. Anyone interested in incorporating a powerful antioxidant into their daily routine for optimal health.
Are there any side effects associated with taking L-Glutathione reduced BioChemica?
L-Glutathione reduced BioChemica is generally safe for most people when taken at recommended doses. However, some individuals may experience mild side effects such as nausea, stomach upset, or allergic reactions. It is essential to consult with a healthcare professional before starting any new supplement regimen, especially if you have underlying health conditions or are pregnant or nursing.
How should L-Glutathione reduced BioChemica be taken for maximum effectiveness?
To optimize the benefits of L-Glutathione reduced BioChemica, it is essential to follow the recommended dosage instructions provided on the product packaging or by a healthcare provider. It is typically taken in capsule or powder form, with or without food, depending on the individual's preferences. Consistency is key when taking L-Glutathione reduced BioChemica, so it is essential to establish a daily routine to ensure optimal results.